/************************************************************************** * * Copyright 2010 VMware, Inc. * All Rights Reserved. * * Permission is hereby granted, free of charge, to any person obtaining a copy * of this software and associated documentation files (the "Software"), to deal * in the Software without restriction, including without limitation the rights * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell * copies of the Software, and to permit persons to whom the Software is * furnished to do so, subject to the following conditions: * * The above copyright notice and this permission notice shall be included in * all copies or substantial portions of the Software. * * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN * THE SOFTWARE. * **************************************************************************/ #include #include "formatter.hpp" #include "trace_dump.hpp" namespace trace { class Dumper : public Visitor { protected: std::ostream &os; DumpFlags dumpFlags; formatter::Formatter *formatter; formatter::Attribute *normal; formatter::Attribute *bold; formatter::Attribute *italic; formatter::Attribute *strike; formatter::Attribute *red; formatter::Attribute *pointer; formatter::Attribute *literal; public: Dumper(std::ostream &_os, DumpFlags _flags) : os(_os), dumpFlags(_flags) { bool color = !(dumpFlags & DUMP_FLAG_NO_COLOR); formatter = formatter::defaultFormatter(color); normal = formatter->normal(); bold = formatter->bold(); italic = formatter->italic(); strike = formatter->strike(); red = formatter->color(formatter::RED); pointer = formatter->color(formatter::GREEN); literal = formatter->color(formatter::BLUE); } ~Dumper() { delete normal; delete bold; delete italic; delete strike; delete red; delete pointer; delete literal; delete formatter; } void visit(Null *) { os << literal << "NULL" << normal; } void visit(Bool *node) { os << literal << (node->value ? "true" : "false") << normal; } void visit(SInt *node) { os << literal << node->value << normal; } void visit(UInt *node) { os << literal << node->value << normal; } void visit(Float *node) { std::streamsize oldPrecision = os.precision(std::numeric_limits::digits10 + 1); os << literal << node->value << normal; os.precision(oldPrecision); } void visit(Double *node) { std::streamsize oldPrecision = os.precision(std::numeric_limits::digits10 + 1); os << literal << node->value << normal; os.precision(oldPrecision); } void visit(String *node) { os << literal << "\""; for (const char *it = node->value; *it; ++it) { unsigned char c = (unsigned char) *it; if (c == '\"') os << "\\\""; else if (c == '\\') os << "\\\\"; else if (c >= 0x20 && c <= 0x7e) os << c; else if (c == '\t') { os << "\t"; } else if (c == '\r') { // Ignore carriage-return } else if (c == '\n') { // Reset formatting so that it looks correct with 'less -R' os << normal << '\n' << literal; } else { unsigned octal0 = c & 0x7; unsigned octal1 = (c >> 3) & 0x7; unsigned octal2 = (c >> 3) & 0x7; os << "\\"; if (octal2) os << octal2; if (octal1) os << octal1; os << octal0; } } os << "\"" << normal; } void visit(Enum *node) { const EnumValue *it = node->lookup(); if (it) { os << literal << it->name << normal; return; } os << literal << node->value << normal; } void visit(Bitmask *bitmask) { unsigned long long value = bitmask->value; const BitmaskSig *sig = bitmask->sig; bool first = true; for (const BitmaskFlag *it = sig->flags; it != sig->flags + sig->num_flags; ++it) { assert(it->value || first); if ((it->value && (value & it->value) == it->value) || (!it->value && value == 0)) { if (!first) { os << " | "; } os << literal << it->name << normal; value &= ~it->value; first = false; } if (value == 0) { break; } } if (value || first) { if (!first) { os << " | "; } os << literal << "0x" << std::hex << value << std::dec << normal; } } const char * visitMembers(Struct *s, const char *sep = "") { for (unsigned i = 0; i < s->members.size(); ++i) { const char *memberName = s->sig->member_names[i]; Value *memberValue = s->members[i]; if (!memberName || !*memberName) { // Anonymous structure Struct *memberStruct = dynamic_cast(memberValue); assert(memberStruct); if (memberStruct) { sep = visitMembers(memberStruct, sep); continue; } } os << sep << italic << memberName << normal << " = ", _visit(memberValue); sep = ", "; } return sep; } void visit(Struct *s) { os << "{"; visitMembers(s); os << "}"; } void visit(Array *array) { if (array->values.size() == 1) { os << "&"; _visit(array->values[0]); } else { const char *sep = ""; os << "{"; for (std::vector::iterator it = array->values.begin(); it != array->values.end(); ++it) { os << sep; _visit(*it); sep = ", "; } os << "}"; } } void visit(Blob *blob) { os << pointer << "blob(" << blob->size << ")" << normal; } void visit(Pointer *p) { os << pointer << "0x" << std::hex << p->value << std::dec << normal; } void visit(Repr *r) { _visit(r->humanValue); } void visit(StackFrame *frame) { if (frame->module != NULL) { os << frame->module << " "; } if (frame->function != NULL) { os << "at " << frame->function << "() "; } if (frame->filename != NULL) { os << "at " << frame->filename; if (frame->linenumber >= 0) { os << ":" << frame->linenumber << " "; } } else { if (frame->offset >= 0) { os << "[" << "0x" << std::hex << frame->offset << std::dec << "]"; } } } void visit(Backtrace & backtrace) { for (int i = 0; i < backtrace.size(); i ++) { visit(backtrace[i]); os << "\n"; } } void visit(Call *call) { CallFlags callFlags = call->flags; if (!(dumpFlags & DUMP_FLAG_NO_CALL_NO)) { os << call->no << " "; } if (callFlags & CALL_FLAG_NON_REPRODUCIBLE) { os << strike; } else if (callFlags & (CALL_FLAG_FAKE | CALL_FLAG_NO_SIDE_EFFECTS)) { os << normal; } else { os << bold; } os << call->sig->name << normal; os << "("; const char *sep = ""; for (unsigned i = 0; i < call->args.size(); ++i) { os << sep; if (!(dumpFlags & DUMP_FLAG_NO_ARG_NAMES)) { os << italic << call->sig->arg_names[i] << normal << " = "; } if (call->args[i].value) { _visit(call->args[i].value); } else { os << "?"; } sep = ", "; } os << ")"; if (call->ret) { os << " = "; _visit(call->ret); } if (callFlags & CALL_FLAG_INCOMPLETE) { os << " // " << red << "incomplete" << normal; } os << "\n"; if (call->backtrace != NULL) { os << bold << red << "Backtrace:\n" << normal; visit(*call->backtrace); } if (callFlags & CALL_FLAG_END_FRAME) { os << "\n"; } } }; void dump(Value *value, std::ostream &os, DumpFlags flags) { Dumper d(os, flags); value->visit(d); } void dump(Call &call, std::ostream &os, DumpFlags flags) { Dumper d(os, flags); d.visit(&call); } } /* namespace trace */